EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO5 |
| Net Charge | 0 |
| Average Mass | 227.216 |
| Monoisotopic Mass | 227.07937 |
| SMILES | N[C@@H](CC1(C(=O)O)C=CC(O)C=C1)C(=O)O |
| InChI | InChI=1S/C10H13NO5/c11-7(8(13)14)5-10(9(15)16)3-1-6(12)2-4-10/h1-4,6-7,12H,5,11H2,(H,13,14)(H,15,16)/t6?,7-,10?/m0/s1 |
| InChIKey | MIEILDYWGANZNH-DSQUFTABSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-arogenic acid (CHEBI:17530) is a arogenic acid (CHEBI:21239) |
| L-arogenic acid (CHEBI:17530) is conjugate acid of L-arogenate(1−) (CHEBI:58180) |
| Incoming Relation(s) |
| L-arogenate(1−) (CHEBI:58180) is conjugate base of L-arogenic acid (CHEBI:17530) |
| IUPAC Name |
|---|
| 1-[(2S)-2-amino-2-carboxyethyl]-4-hydroxycyclohexa-2,5-diene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| alpha-Amino-1-carboxy-4-hydroxy-2,5-cyclohexadiene-1-propanoic acid | ChemIDplus |
| L-Arogenate | KEGG COMPOUND |
| L-Arogenic acid | KEGG COMPOUND |
| Pretyrosine | KEGG COMPOUND |