EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O8 |
| Net Charge | 0 |
| Average Mass | 336.296 |
| Monoisotopic Mass | 336.08452 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C=C(C(=O)O)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H16O8/c17-10-3-1-8(5-11(10)18)2-4-14(20)24-13-7-9(16(22)23)6-12(19)15(13)21/h1-5,7,12-13,15,17-19,21H,6H2,(H,22,23)/b4-2+/t12-,13-,15+/m1/s1 |
| InChIKey | MRDAXWGGWWDUKL-VKJPNVGWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-Caffeoylshikimic acid (CHEBI:175268) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (3R,4S,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-4,5-dihydroxycyclohexene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8307341 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:180981-12-8 | ChemIDplus |