EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O5 |
| Net Charge | 0 |
| Average Mass | 330.380 |
| Monoisotopic Mass | 330.14672 |
| SMILES | C=C1C2CC(O)C34C1C3(C2)C(C(=O)O)C1C2(C)CCCC14OC2=O |
| InChI | InChI=1S/C19H22O5/c1-8-9-6-10(20)19-12(8)17(19,7-9)11(14(21)22)13-16(2)4-3-5-18(13,19)24-15(16)23/h9-13,20H,1,3-7H2,2H3,(H,21,22) |
| InChIKey | APBPHWLOGNJBLH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gibberellin A108 (CHEBI:175215) is a C19-gibberellin (CHEBI:20858) |
| Gibberellin A108 (CHEBI:175215) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| IUPAC Name |
|---|
| 3-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxahexacyclo[9.3.2.15,8.01,10.02,7.02,8]heptadecane-9-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031095 | HMDB |
| 35013315 | ChemSpider |