EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O8 |
| Net Charge | 0 |
| Average Mass | 330.248 |
| Monoisotopic Mass | 330.03757 |
| SMILES | COc1cc2c(=O)oc3c(O)c(O)cc4c(=O)oc(c1OC)c2c34 |
| InChI | InChI=1S/C16H10O8/c1-21-8-4-6-10-9-5(15(19)24-14(10)12(8)22-2)3-7(17)11(18)13(9)23-16(6)20/h3-4,17-18H,1-2H3 |
| InChIKey | DMPZOHHHRRENRS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-Di-O-methylellagic acid (CHEBI:175201) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 6,7-dihydroxy-13,14-dimethoxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
| Manual Xrefs | Databases |
|---|---|
| 4475829 | ChemSpider |
| HMDB0041395 | HMDB |