EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O8 |
| Net Charge | 0 |
| Average Mass | 330.248 |
| Monoisotopic Mass | 330.03757 |
| SMILES | CC1(O)C(=O)c2c(O)c(C(=O)O)cc(O)c2C2=C1C(=O)C=CC2=O |
| InChI | InChI=1S/C16H10O8/c1-16(24)12-7(18)3-2-6(17)10(12)9-8(19)4-5(15(22)23)13(20)11(9)14(16)21/h2-4,19-20,24H,1H3,(H,22,23) |
| InChIKey | YFUQJMOETZJFHO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Blighinone (CHEBI:175199) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 1,4,9-trihydroxy-9-methyl-5,8,10-trioxophenanthrene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 35013247 | ChemSpider |
| HMDB0030643 | HMDB |