EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2 |
| Net Charge | 0 |
| Average Mass | 103.121 |
| Monoisotopic Mass | 103.06333 |
| SMILES | CN[C@@H](C)C(=O)O |
| InChI | InChI=1S/C4H9NO2/c1-3(5-2)4(6)7/h3,5H,1-2H3,(H,6,7)/t3-/m0/s1 |
| InChIKey | GDFAOVXKHJXLEI-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-L-alanine (CHEBI:17519) is a methyl-L-alanine (CHEBI:25264) |
| N-methyl-L-alanine (CHEBI:17519) is tautomer of N-methyl-L-alanine zwitterion (CHEBI:58175) |
| Incoming Relation(s) |
| N-methyl-L-alanine zwitterion (CHEBI:58175) is tautomer of N-methyl-L-alanine (CHEBI:17519) |
| IUPAC Names |
|---|
| (2S)-2-(methylamino)propanoic acid |
| N-methyl-L-alanine |
| Synonyms | Source |
|---|---|
| N-Methyl-L-alanine | KEGG COMPOUND |
| (S)-2-methylaminopropanoic acid | ChEBI |
| N-Methylalanine | ChemIDplus |
| Citations |
|---|