EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO4 |
| Net Charge | 0 |
| Average Mass | 327.380 |
| Monoisotopic Mass | 327.14706 |
| SMILES | [H][C@@]12Cc3ccc(OC)c(O)c3-c3c(OC)c(OC)cc(c31)CCN2 |
| InChI | InChI=1S/C19H21NO4/c1-22-13-5-4-10-8-12-15-11(6-7-20-12)9-14(23-2)19(24-3)17(15)16(10)18(13)21/h4-5,9,12,20-21H,6-8H2,1-3H3/t12-/m1/s1 |
| InChIKey | OHDQLTAYHMLRBA-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-Norisocorydine (CHEBI:175179) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| (6aR)-1,2,10-trimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031921 | HMDB |
| 30776920 | ChemSpider |