EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O4 |
| Net Charge | 0 |
| Average Mass | 326.392 |
| Monoisotopic Mass | 326.15181 |
| SMILES | COc1cc(CCC(=O)CC(=O)CCc2ccccc2)ccc1O |
| InChI | InChI=1S/C20H22O4/c1-24-20-13-16(9-12-19(20)23)8-11-18(22)14-17(21)10-7-15-5-3-2-4-6-15/h2-6,9,12-13,23H,7-8,10-11,14H2,1H3 |
| InChIKey | NMQRUGZIKWUACB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-Hydroxy-3-methoxyphenyl)-7-phenyl-3,5-heptanedione (CHEBI:175170) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3-methoxyphenyl)-7-phenylheptane-3,5-dione |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033710 | HMDB |
| 30777028 | ChemSpider |