EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O5 |
| Net Charge | 0 |
| Average Mass | 326.348 |
| Monoisotopic Mass | 326.11542 |
| SMILES | COc1cc(/C=C\C(=O)/C=C\c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C19H18O5/c1-23-18-11-13(5-9-16(18)21)3-7-15(20)8-4-14-6-10-17(22)19(12-14)24-2/h3-12,21-22H,1-2H3/b7-3-,8-4- |
| InChIKey | ISIMGBQRFXXNON-VHOZIDCHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,5-Bis(4-hydroxy-3-methoxyphenyl)-1,4-pentadien-3-one (CHEBI:175163) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (1Z,4Z)-1,5-bis(4-hydroxy-3-methoxyphenyl)penta-1,4-dien-3-one |
| Manual Xrefs | Databases |
|---|---|
| 30777523 | ChemSpider |
| HMDB0040930 | HMDB |