EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NO4 |
| Net Charge | 0 |
| Average Mass | 325.364 |
| Monoisotopic Mass | 325.13141 |
| SMILES | COc1c(O)cc2c3c1-c1cc4c(cc1CC3N(C)CC2)OCO4 |
| InChI | InChI=1S/C19H19NO4/c1-20-4-3-10-6-14(21)19(22-2)18-12-8-16-15(23-9-24-16)7-11(12)5-13(20)17(10)18/h6-8,13,21H,3-5,9H2,1-2H3 |
| InChIKey | OGJUMNZGTZWIBO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isodomesticine (CHEBI:175149) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| 19-methoxy-13-methyl-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaen-18-ol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033360 | HMDB |
| 28283320 | ChemSpider |