EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NO4 |
| Net Charge | 0 |
| Average Mass | 325.364 |
| Monoisotopic Mass | 325.13141 |
| SMILES | COc1cc2c3c(c1OC)-c1cc4c(cc1CC3NCC2)OCO4 |
| InChI | InChI=1S/C19H19NO4/c1-21-16-6-10-3-4-20-13-5-11-7-14-15(24-9-23-14)8-12(11)18(17(10)13)19(16)22-2/h6-8,13,20H,3-5,9H2,1-2H3 |
| InChIKey | JWXKBCGJLCEZTJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nornantenine (CHEBI:175147) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| 18,19-dimethoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaene |
| Manual Xrefs | Databases |
|---|---|
| 2341325 | ChemSpider |
| HMDB0030245 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:15401-66-8 | ChemIDplus |