EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22N2O8 |
| Net Charge | 0 |
| Average Mass | 322.314 |
| Monoisotopic Mass | 322.13762 |
| SMILES | NCCCCC(NC1OC(C(=O)O)C(O)C(O)C1O)C(=O)O |
| InChI | InChI=1S/C12H22N2O8/c13-4-2-1-3-5(11(18)19)14-10-8(17)6(15)7(16)9(22-10)12(20)21/h5-10,14-17H,1-4,13H2,(H,18,19)(H,20,21) |
| InChIKey | HFIFPDNTHBGIPX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-Galacturonyl-L-lysine (CHEBI:175119) is a glyco-amino acid (CHEBI:35258) |
| IUPAC Name |
|---|
| 6-[(5-amino-1-carboxypentyl)amino]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033105 | HMDB |
| 35013548 | ChemSpider |