EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O8S2 |
| Net Charge | 0 |
| Average Mass | 320.300 |
| Monoisotopic Mass | 319.96606 |
| SMILES | O=S(=O)(O)c1cc(O)c2c(O)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C10H8O8S2/c11-8-3-6(19(13,14)15)1-5-2-7(20(16,17)18)4-9(12)10(5)8/h1-4,11-12H,(H,13,14,15)(H,16,17,18) |
| InChIKey | HLVXFWDLRHCZEI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | indicator Anything used in a scientific experiment to indicate the presence of a substance or quality, change in a body, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chromotropic acid (CHEBI:1751) has role indicator (CHEBI:47867) |
| chromotropic acid (CHEBI:1751) is a naphthalenediols (CHEBI:23783) |
| chromotropic acid (CHEBI:1751) is a naphthalenesulfonic acid (CHEBI:36336) |
| IUPAC Name |
|---|
| 4,5-dihydroxynaphthalene-2,7-disulfonic acid |
| Synonyms | Source |
|---|---|
| Chromotropic acid | KEGG COMPOUND |
| 4,5-Dihydroxynaphthalene-2,7-disulfonic acid | KEGG COMPOUND |
| 4,5-Dihydroxynaphthalene-2,7-disulfonic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11323 | KEGG COMPOUND |
| Chromotropic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1827764 | Reaxys |
| CAS:148-25-4 | KEGG COMPOUND |
| CAS:148-25-4 | ChemIDplus |
| Citations |
|---|