EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O5 |
| Net Charge | 0 |
| Average Mass | 316.353 |
| Monoisotopic Mass | 316.13107 |
| SMILES | COc1ccc(C(=O)OC(c2ccc(OC)cc2)C(C)O)cc1 |
| InChI | InChI=1S/C18H20O5/c1-12(19)17(13-4-8-15(21-2)9-5-13)23-18(20)14-6-10-16(22-3)11-7-14/h4-12,17,19H,1-3H3 |
| InChIKey | PCUOEOPTDCUNQQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Verimol B (CHEBI:175066) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| [2-hydroxy-1-(4-methoxyphenyl)propyl] 4-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 22370444 | ChemSpider |
| HMDB0038323 | HMDB |