EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O5 |
| Net Charge | 0 |
| Average Mass | 314.337 |
| Monoisotopic Mass | 314.11542 |
| SMILES | COc1cc(/C=C/C(=O)OCCc2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C18H18O5/c1-22-17-12-14(4-8-16(17)20)5-9-18(21)23-11-10-13-2-6-15(19)7-3-13/h2-9,12,19-20H,10-11H2,1H3/b9-5+ |
| InChIKey | JMSFLLZUCIXALN-WEVVVXLNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-Hydroxyphenethyl trans-ferulate (CHEBI:175029) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 2-(4-hydroxyphenyl)ethyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 552938 | ChemSpider |
| HMDB0032806 | HMDB |