EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O4 |
| Net Charge | 0 |
| Average Mass | 380.484 |
| Monoisotopic Mass | 380.19876 |
| SMILES | CC(C)=CCc1c(O)c(CC=C(C)C)c2c(c1O)-c1cc(O)c(O)cc1CC2 |
| InChI | InChI=1S/C24H28O4/c1-13(2)5-8-17-16-10-7-15-11-20(25)21(26)12-19(15)22(16)24(28)18(23(17)27)9-6-14(3)4/h5-6,11-12,25-28H,7-10H2,1-4H3 |
| InChIKey | YJJXCOSDPIJFJR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gancaonin U (CHEBI:175023) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 6,8-bis(3-methylbut-2-enyl)-9,10-dihydrophenanthrene-2,3,5,7-tetrol |
| Manual Xrefs | Databases |
|---|---|
| 421879 | ChemSpider |
| HMDB0037587 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:134958-56-8 | ChemIDplus |