EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O4 |
| Net Charge | 0 |
| Average Mass | 380.444 |
| Monoisotopic Mass | 380.17361 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)NCCCCNC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C22H24N2O4/c25-19-9-3-17(4-10-19)7-13-21(27)23-15-1-2-16-24-22(28)14-8-18-5-11-20(26)12-6-18/h3-14,25-26H,1-2,15-16H2,(H,23,27)(H,24,28)/b13-7+,14-8+ |
| InChIKey | PYVBFDCHJDMSMM-FNCQTZNRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Di-4-coumaroylputrescine (CHEBI:175016) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(4-hydroxyphenyl)-N-[4-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]butyl]prop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 30777007 | ChemSpider |
| HMDB0033466 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:364048-94-2 | ChemIDplus |