EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O4 |
| Net Charge | 0 |
| Average Mass | 312.365 |
| Monoisotopic Mass | 312.13616 |
| SMILES | CC(C)=CCc1c(O)cc(O)c2c1CCc1cc(O)c(O)cc1-2 |
| InChI | InChI=1S/C19H20O4/c1-10(2)3-5-12-13-6-4-11-7-16(21)17(22)8-14(11)19(13)18(23)9-15(12)20/h3,7-9,20-23H,4-6H2,1-2H3 |
| InChIKey | UEXOPXIMQJMWKA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gancaonin V (CHEBI:174997) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 8-(3-methylbut-2-enyl)-9,10-dihydrophenanthrene-2,3,5,7-tetrol |
| Manual Xrefs | Databases |
|---|---|
| 421878 | ChemSpider |
| HMDB0037586 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:134958-57-9 | ChemIDplus |