EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O9 |
| Net Charge | 0 |
| Average Mass | 312.230 |
| Monoisotopic Mass | 312.04813 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H](C(=O)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C13H12O9/c14-7-3-1-6(5-8(7)15)2-4-9(16)22-11(13(20)21)10(17)12(18)19/h1-5,10-11,14-15,17H,(H,18,19)(H,20,21)/b4-2+/t10-,11-/m1/s1 |
| InChIKey | SWGKAHCIOQPKFW-JTNORFRNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Caftaric acid (CHEBI:174975) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (2R,3R)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-hydroxybutanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 4944664 | ChemSpider |
| HMDB0013680 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:67879-58-7 | ChemIDplus |