EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O4 |
| Net Charge | 0 |
| Average Mass | 308.418 |
| Monoisotopic Mass | 308.19876 |
| SMILES | [H][C@]12C=C(C)[C@@H](C(=O)O)[C@@](C)(C(=O)CCO)C1C(C)CC(C)C2 |
| InChI | InChI=1S/C18H28O4/c1-10-7-11(2)15-13(8-10)9-12(3)16(17(21)22)18(15,4)14(20)5-6-19/h9-11,13,15-16,19H,5-8H2,1-4H3,(H,21,22)/t10?,11?,13-,15?,16-,18-/m0/s1 |
| InChIKey | SFTQDPVLDKOILY-CSVHMLKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diplodia (ncbitaxon:66735) | - | DOI (10.1016/0040-4020(72)88086-4) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Diplodiatoxin (CHEBI:174949) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Names |
|---|
| 1-(3-hydroxypropanoyl)-1,3,6,8-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-2-carboxylic acid |
| (1S,2R,4aS)-1-(3-hydroxypropanoyl)-1,3,6,8-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 158030 | ChemSpider |
| 35013371 | ChemSpider |
| HMDB0031471 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:41060-01-9 | ChemIDplus |