EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O6 |
| Net Charge | 0 |
| Average Mass | 304.298 |
| Monoisotopic Mass | 304.09469 |
| SMILES | [H][C@]1(c2ccc(OC)c(O)c2)Oc2cc(O)cc(O)c2C[C@H]1O |
| InChI | InChI=1S/C16H16O6/c1-21-14-3-2-8(4-12(14)19)16-13(20)7-10-11(18)5-9(17)6-15(10)22-16/h2-6,13,16-20H,7H2,1H3/t13-,16-/m1/s1 |
| InChIKey | ZHDMPVIDHWJGTN-CZUORRHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | urine (BTO:0001419) | PubMed (9929521) |
| Roles Classification |
|---|
| Biological Role: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-O-methyl-(−)-epicatechin (CHEBI:174910) has functional parent (−)-epicatechin (CHEBI:90) |
| 4'-O-methyl-(−)-epicatechin (CHEBI:174910) has role geroprotector (CHEBI:176497) |
| 4'-O-methyl-(−)-epicatechin (CHEBI:174910) has role rat metabolite (CHEBI:86264) |
| 4'-O-methyl-(−)-epicatechin (CHEBI:174910) is a catechin (CHEBI:23053) |
| 4'-O-methyl-(−)-epicatechin (CHEBI:174910) is a monomethoxybenzene (CHEBI:25235) |
| 4'-O-methyl-(−)-epicatechin (CHEBI:174910) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (2R,3R)-2-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| Synonyms | Source |
|---|---|
| (2R,3R)-2-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol | IUPAC |
| (2R,3R)-3,4-dihydro-2-(3-hydroxy-4-methoxyphenyl)-2H-1-benzopyran-3,5,7-triol | ChEBI |
| (2R-cis)-3,4-dihydro-2-(3-hydroxy-4-methoxyphenyl)-2H-1-benzopyran-3,5,7-triol | ChEBI |
| 4'-O-methyl-epicatechin | ChemIDplus |
| 4'-O-methylepicatechin | ChEBI |
| 4'-methylepicatechin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 30776736 | ChemSpider |
| HMDB0029179 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:97914-20-0 | ChemIDplus |
| Citations |
|---|