EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO4 |
| Net Charge | 0 |
| Average Mass | 303.358 |
| Monoisotopic Mass | 303.14706 |
| SMILES | [H][C@@]12Oc3c(O)ccc4c3[C@@]13CCN(C)[C@]([H])(C4)[C@]3(O)CC[C@H]2O |
| InChI | InChI=1S/C17H21NO4/c1-18-7-6-16-13-9-2-3-10(19)14(13)22-15(16)11(20)4-5-17(16,21)12(18)8-9/h2-3,11-12,15,19-21H,4-8H2,1H3/t11-,12-,15+,16+,17-/m1/s1 |
| InChIKey | AABLHGPVOULICI-LQPBRMSDSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beta-oxymorphol (CHEBI:174903) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4R,4aS,7R,7aR,12bS)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzouro[3,2-e]isoquinoline-4a,7,9-triol |
| Manual Xrefs | Databases |
|---|---|
| 10485439 | ChemSpider |
| HMDB0061076 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:54934-75-7 | ChemIDplus |