EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO4 |
| Net Charge | 0 |
| Average Mass | 303.358 |
| Monoisotopic Mass | 303.14706 |
| SMILES | [H][C@@]12Oc3c(OC)ccc4c3[C@@]13CCNC(C4)[C@]3(O)CC[C@H]2O |
| InChI | InChI=1S/C17H21NO4/c1-21-11-3-2-9-8-12-17(20)5-4-10(19)15-16(17,6-7-18-12)13(9)14(11)22-15/h2-3,10,12,15,18-20H,4-8H2,1H3/t10-,12?,15+,16+,17-/m1/s1 |
| InChIKey | KFWOOLJUSYSBAD-SGPGVZRMSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beta-noroxycodol (CHEBI:174902) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4aS,7R,7aR,12bS)-9-methoxy-2,3,4,5,6,7,7a,13-octahydro-1H-4,12-methanobenzouro[3,2-e]isoquinoline-4a,7-diol |
| Manual Xrefs | Databases |
|---|---|
| 35031840 | ChemSpider |
| HMDB0061075 | HMDB |