EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O5 |
| Net Charge | 0 |
| Average Mass | 282.251 |
| Monoisotopic Mass | 282.05282 |
| SMILES | O=C1/C(=C/c2ccccc2)Oc2cc(O)c3c(c21)OCO3 |
| InChI | InChI=1S/C16H10O5/c17-10-7-11-13(16-15(10)19-8-20-16)14(18)12(21-11)6-9-4-2-1-3-5-9/h1-7,17H,8H2/b12-6- |
| InChIKey | KLYHONUCJQKOKE-SDQBBNPISA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-methylenedioxy-6-hydroxyaurone (CHEBI:1749) has functional parent aurone (CHEBI:47964) |
| 4,5-methylenedioxy-6-hydroxyaurone (CHEBI:1749) has role plant metabolite (CHEBI:76924) |
| 4,5-methylenedioxy-6-hydroxyaurone (CHEBI:1749) is a hydroxyaurone (CHEBI:85970) |
| IUPAC Name |
|---|
| (7Z)-7-benzylidene-4-hydroxy-2H-furo[3,2-e][1,3]benzodioxol-8(7H)-one |
| Synonym | Source |
|---|---|
| cephalocerone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002385 | KNApSAcK |
| C08722 | KEGG COMPOUND |
| LMPK12130053 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4756987 | Reaxys |
| CAS:135383-79-8 | KEGG COMPOUND |