EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O3 |
| Net Charge | 0 |
| Average Mass | 298.382 |
| Monoisotopic Mass | 298.15689 |
| SMILES | Oc1ccc(CCC(O)CC/C=C/c2ccccc2)cc1O |
| InChI | InChI=1S/C19H22O3/c20-17(9-5-4-8-15-6-2-1-3-7-15)12-10-16-11-13-18(21)19(22)14-16/h1-4,6-8,11,13-14,17,20-22H,5,9-10,12H2/b8-4+ |
| InChIKey | OELWYQGRQUQQPD-XBXARRHUSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(3-Hydroxy-7-phenyl-6-heptenyl)-1,2-benzenediol (CHEBI:174843) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 4-[(E)-3-hydroxy-7-phenylhept-6-enyl]benzene-1,2-diol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041089 | HMDB |
| 8193153 | ChemSpider |