EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O3 |
| Net Charge | 0 |
| Average Mass | 298.382 |
| Monoisotopic Mass | 298.15689 |
| SMILES | O=C(CCc1ccccc1)CC(O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H22O3/c20-17-10-6-16(7-11-17)9-13-19(22)14-18(21)12-8-15-4-2-1-3-5-15/h1-7,10-11,19-20,22H,8-9,12-14H2 |
| InChIKey | UNMNJFPAJOHXMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Hydroxy-7-(4-hydroxyphenyl)-1-phenyl-3-heptanone (CHEBI:174841) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 5-hydroxy-7-(4-hydroxyphenyl)-1-phenylheptan-3-one |
| Manual Xrefs | Databases |
|---|---|
| 8215903 | ChemSpider |
| HMDB0033711 | HMDB |