EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O4 |
| Net Charge | 0 |
| Average Mass | 296.322 |
| Monoisotopic Mass | 296.10486 |
| SMILES | COc1cc(/C=C\C(=O)/C=C\c2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C18H16O4/c1-22-18-12-14(6-11-17(18)21)5-10-16(20)9-4-13-2-7-15(19)8-3-13/h2-12,19,21H,1H3/b9-4-,10-5- |
| InChIKey | QVRYUUYYIWAQHV-AVWDGMTFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-Hydroxy-3-methoxyphenyl)-5-(4-hydroxyphenyl)-1,4-pentadien-3-one (CHEBI:174813) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (1Z,4Z)-1-(4-hydroxy-3-methoxyphenyl)-5-(4-hydroxyphenyl)penta-1,4-dien-3-one |
| Manual Xrefs | Databases |
|---|---|
| 30777524 | ChemSpider |
| HMDB0040931 | HMDB |