EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O8 |
| Net Charge | 0 |
| Average Mass | 296.231 |
| Monoisotopic Mass | 296.05322 |
| SMILES | COc1cc(/C=C/C(=O)OC(C(=O)O)C(=O)O)ccc1O |
| InChI | InChI=1S/C13H12O8/c1-20-9-6-7(2-4-8(9)14)3-5-10(15)21-11(12(16)17)13(18)19/h2-6,11,14H,1H3,(H,16,17)(H,18,19)/b5-3+ |
| InChIKey | ZWXOJLRXYPVVQY-HWKANZROSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-Feruloyltartronic acid (CHEBI:174811) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 2-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxypropanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 30776964 | ChemSpider |
| HMDB0032957 | HMDB |