EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NOS |
| Net Charge | 0 |
| Average Mass | 295.407 |
| Monoisotopic Mass | 295.10309 |
| SMILES | O=C1Cc2ccccc2C(=C2CCNCC2)c2ccsc21 |
| InChI | InChI=1S/C18H17NOS/c20-16-11-13-3-1-2-4-14(13)17(12-5-8-19-9-6-12)15-7-10-21-18(15)16/h1-4,7,10,19H,5-6,8-9,11H2 |
| InChIKey | IYSYPCSSDZBWHN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nor-ketotifen (CHEBI:174806) has role antiviral agent (CHEBI:22587) |
| Nor-ketotifen (CHEBI:174806) is a organosulfur heterocyclic compound (CHEBI:38106) |
| IUPAC Name |
|---|
| 2-piperidin-4-ylidene-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
| Synonyms | Source |
|---|---|
| N-desmethylketotifen | ChEMBL |
| norketotifen | ChEMBL |
| Norketotifen | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 8079890 | ChemSpider |
| HMDB0060646 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:34580-20-6 | ChemIDplus |