EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NO6 |
| Net Charge | 0 |
| Average Mass | 295.291 |
| Monoisotopic Mass | 295.10559 |
| SMILES | N#CC(OC1OC(CO)C(O)C(O)C1O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO6/c15-6-9(8-4-2-1-3-5-8)20-14-13(19)12(18)11(17)10(7-16)21-14/h1-5,9-14,16-19H,7H2 |
| InChIKey | ZKSZEJFBGODIJW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-Hydroxy-2-phenylacetonitrile O-b-D-allopyranoside (CHEBI:174805) is a cyanogenic glycoside (CHEBI:23436) |
| IUPAC Name |
|---|
| 2-phenyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetonitrile |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039961 | HMDB |
| 500824 | ChemSpider |