EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13NO4 |
| Net Charge | 0 |
| Average Mass | 283.283 |
| Monoisotopic Mass | 283.08446 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C16H13NO4/c18-12-8-5-11(6-9-12)7-10-15(19)17-14-4-2-1-3-13(14)16(20)21/h1-10,18H,(H,17,19)(H,20,21)/b10-7+ |
| InChIKey | INBHLTYBRKASIZ-JXMROGBWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Avenanthramide 1p (CHEBI:174705) is a alkaloid (CHEBI:22315) |
| Avenanthramide 1p (CHEBI:174705) is a benzamides (CHEBI:22702) |
| IUPAC Name |
|---|
| 2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4947061 | ChemSpider |
| HMDB0029282 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:53901-55-6 | ChemIDplus |