EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N6O8P |
| Net Charge | 0 |
| Average Mass | 466.347 |
| Monoisotopic Mass | 466.10020 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)Nc2ccccc2C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H19N6O8P/c18-14-11-15(20-6-19-14)23(7-21-11)16-13(25)12(24)10(31-16)5-30-32(28,29)22-9-4-2-1-3-8(9)17(26)27/h1-4,6-7,10,12-13,16,24-25H,5H2,(H,26,27)(H2,18,19,20)(H2,22,28,29)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | VRPRDYILQKJWNN-XNIJJKJLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-adenylylanthranilic acid (CHEBI:17469) has functional parent anthranilic acid (CHEBI:30754) |
| N-adenylylanthranilic acid (CHEBI:17469) is a organic phosphoramidate (CHEBI:37773) |
| N-adenylylanthranilic acid (CHEBI:17469) is conjugate acid of N-adenylylanthranilate (CHEBI:58156) |
| Incoming Relation(s) |
| N-adenylylanthranilate (CHEBI:58156) is conjugate base of N-adenylylanthranilic acid (CHEBI:17469) |
| IUPAC Name |
|---|
| 2-[N-(5'-adenylyl)amino]benzoic acid |
| Synonym | Source |
|---|---|
| 5'-O-{[(2-carboxyphenyl)amino](hydroxy)phosphoryl}adenosine | IUPAC |
| Citations |
|---|