EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O4 |
| Net Charge | 0 |
| Average Mass | 346.467 |
| Monoisotopic Mass | 346.21441 |
| SMILES | CCCCCCCCCC(=O)CC(=O)/C=C\c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C21H30O4/c1-3-4-5-6-7-8-9-10-18(22)16-19(23)13-11-17-12-14-20(24)21(15-17)25-2/h11-15,24H,3-10,16H2,1-2H3/b13-11- |
| InChIKey | QJDGTTCAEQPSJA-QBFSEMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [10]-Dehydrogingerdione (CHEBI:174685) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (Z)-1-(4-hydroxy-3-methoxyphenyl)tetradec-1-ene-3,5-dione |
| Manual Xrefs | Databases |
|---|---|
| 30776778 | ChemSpider |
| HMDB0029476 | HMDB |