EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O5 |
| Net Charge | 0 |
| Average Mass | 278.304 |
| Monoisotopic Mass | 278.11542 |
| SMILES | C=C(C(=O)O)C(/C=C1\C(=O)C=CC1(C)O)CCC(C)=O |
| InChI | InChI=1S/C15H18O5/c1-9(16)4-5-11(10(2)14(18)19)8-12-13(17)6-7-15(12,3)20/h6-8,11,20H,2,4-5H2,1,3H3,(H,18,19)/b12-8+ |
| InChIKey | ARZDSTJTDVJYCF-XYOKQWHBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Achimilic acid (CHEBI:174657) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 3-[(Z)-(2-hydroxy-2-methyl-5-oxocyclopent-3-en-1-ylidene)methyl]-2-methylidene-6-oxoheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 35014401 | ChemSpider |
| HMDB0037325 | HMDB |