EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O5 |
| Net Charge | 0 |
| Average Mass | 278.304 |
| Monoisotopic Mass | 278.11542 |
| SMILES | Cc1cc2c(cc1O)C(=O)C(O)C1CCC(O)C(O)C21 |
| InChI | InChI=1S/C15H18O5/c1-6-4-8-9(5-11(6)17)14(19)13(18)7-2-3-10(16)15(20)12(7)8/h4-5,7,10,12-13,15-18,20H,2-3H2,1H3 |
| InChIKey | MBBMNXMKZBEZIP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Solanolone (CHEBI:174654) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 3,4,7,10-tetrahydroxy-6-methyl-2,3,4,4a,10,10a-hexahydro-1H-phenanthren-9-one |
| Manual Xrefs | Databases |
|---|---|
| 35013571 | ChemSpider |
| HMDB0033262 | HMDB |