EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25NO4 |
| Net Charge | 0 |
| Average Mass | 343.423 |
| Monoisotopic Mass | 343.17836 |
| SMILES | Oc1ccc2c3c1OC1C(O)CCC4(O)C(C2)N(CC2CC2)CCC314 |
| InChI | InChI=1S/C20H25NO4/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)25-18)7-8-21(15)10-11-1-2-11/h3-4,11,14-15,18,22-24H,1-2,5-10H2 |
| InChIKey | JLVNEHKORQFVQJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-beta-Naltrexol (CHEBI:174632) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 3-(cyclopropylmethyl)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzouro[3,2-e]isoquinoline-4a,7,9-triol |
| Manual Xrefs | Databases |
|---|---|
| 548113 | ChemSpider |
| HMDB0060784 | HMDB |