EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O3 |
| Net Charge | 0 |
| Average Mass | 342.479 |
| Monoisotopic Mass | 342.21949 |
| SMILES | [H][C@@]12CCC3=CC(=O)[C@H](CO)C[C@]3(C)[C@@]1([H])CC[C@]1(C)C(O)(C#C)CC[C@@]21[H] |
| InChI | InChI=1S/C22H30O3/c1-4-22(25)10-8-18-16-6-5-15-11-19(24)14(13-23)12-20(15,2)17(16)7-9-21(18,22)3/h1,11,14,16-18,23,25H,5-10,12-13H2,2-3H3/t14-,16+,17-,18-,20-,21-,22?/m0/s1 |
| InChIKey | JGJFMZZHCOKXHX-RIONBYPISA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-Hydroxymethylethisterone (CHEBI:174628) has role androgen (CHEBI:50113) |
| 17-Hydroxymethylethisterone (CHEBI:174628) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (2S,8R,9S,10R,13S,14S)-17-ethynyl-17-hydroxy-2-(hydroxymethyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| Manual Xrefs | Databases |
|---|---|
| 141166 | ChemSpider |
| HMDB0060710 | HMDB |