EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O3 |
| Net Charge | 0 |
| Average Mass | 274.360 |
| Monoisotopic Mass | 274.15689 |
| SMILES | CCCCC/C=C/C(=O)/C=C/c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C17H22O3/c1-3-4-5-6-7-8-15(18)11-9-14-10-12-16(19)17(13-14)20-2/h7-13,19H,3-6H2,1-2H3/b8-7+,11-9+ |
| InChIKey | JLXKTAQNHHXFHL-MFDVASPDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [6]-Dehydroshogaol (CHEBI:174624) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (1E,4E)-1-(4-hydroxy-3-methoxyphenyl)deca-1,4-dien-3-one |
| Manual Xrefs | Databases |
|---|---|
| 57421491 | ChemSpider |