EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O6 |
| Net Charge | 0 |
| Average Mass | 182.172 |
| Monoisotopic Mass | 182.07904 |
| SMILES | OC[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h1212h]/1/ |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5+,6+/m1/s1 |
| InChIKey | FBPFZTCFMRRESA-ZXXMMSQZSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-iditol (CHEBI:17459) has role fungal metabolite (CHEBI:76946) |
| D-iditol (CHEBI:17459) is a iditol (CHEBI:24766) |
| D-iditol (CHEBI:17459) is enantiomer of L-iditol (CHEBI:18202) |
| Incoming Relation(s) |
| L-iditol (CHEBI:18202) is enantiomer of D-iditol (CHEBI:17459) |
| IUPAC Name |
|---|
| D-iditol |
| Synonyms | Source |
|---|---|
| (2R,3S,4S,5R)-hexane-1,2,3,4,5,6-hexol | IUPAC |
| D-Iditol | KEGG COMPOUND |
| D-Idit | ChEBI |
| UniProt Name | Source |
|---|---|
| D-iditol | UniProt |
| Citations |
|---|