EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O4 |
| Net Charge | 0 |
| Average Mass | 270.284 |
| Monoisotopic Mass | 270.08921 |
| SMILES | COc1cc2c(ccc3cc(O)cc(OC)c32)cc1O |
| InChI | InChI=1S/C16H14O4/c1-19-14-8-12-9(6-13(14)18)3-4-10-5-11(17)7-15(20-2)16(10)12/h3-8,17-18H,1-2H3 |
| InChIKey | YKFWCNBTQYCJQV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-Dimethoxy-2,7-phenanthrenediol (CHEBI:174552) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| 3,5-dimethoxyphenanthrene-2,7-diol |
| Manual Xrefs | Databases |
|---|---|
| 24713345 | ChemSpider |
| HMDB0031612 | HMDB |