EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O3 |
| Net Charge | 0 |
| Average Mass | 336.391 |
| Monoisotopic Mass | 336.14739 |
| SMILES | COc1cc(/C=C/C(=O)NCCc2cnc3ccccc23)ccc1O |
| InChI | InChI=1S/C20H20N2O3/c1-25-19-12-14(6-8-18(19)23)7-9-20(24)21-11-10-15-13-22-17-5-3-2-4-16(15)17/h2-9,12-13,22-23H,10-11H2,1H3,(H,21,24)/b9-7+ |
| InChIKey | LWRQDNUXWLIWDB-VQHVLOKHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nb-Feruloyltryptamine (CHEBI:174537) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(1H-indol-3-yl)ethyl]prop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 557005 | ChemSpider |
| HMDB0041519 | HMDB |