EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H11NO3 |
| Net Charge | 0 |
| Average Mass | 265.268 |
| Monoisotopic Mass | 265.07389 |
| SMILES | COc1cc2c3c(cc4ccccc4c3c1O)NC2=O |
| InChI | InChI=1S/C16H11NO3/c1-20-12-7-10-13-11(17-16(10)19)6-8-4-2-3-5-9(8)14(13)15(12)18/h2-7,18H,1H3,(H,17,19) |
| InChIKey | KBGNBPGXVKPRQI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Piperolactam A (CHEBI:174488) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| 15-hydroxy-14-methoxy-10-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,4,6,8,12,14-heptaen-11-one |
| Manual Xrefs | Databases |
|---|---|
| 2338707 | ChemSpider |
| HMDB0033060 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:112501-42-5 | ChemIDplus |