EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O4 |
| Net Charge | 0 |
| Average Mass | 262.305 |
| Monoisotopic Mass | 262.12051 |
| SMILES | CCCCC#CC(O)c1ccc(/C=C\C(=O)OC)o1 |
| InChI | InChI=1S/C15H18O4/c1-3-4-5-6-7-13(16)14-10-8-12(19-14)9-11-15(17)18-2/h8-11,13,16H,3-5H2,1-2H3/b11-9- |
| InChIKey | LQJHQXFOPADMRA-LUAWRHEFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrowyerol (CHEBI:174464) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| methyl (Z)-3-[5-(1-hydroxyhept-2-ynyl)uran-2-yl]prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 35014811 | ChemSpider |
| HMDB0039497 | HMDB |