EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O3 |
| Net Charge | 0 |
| Average Mass | 328.452 |
| Monoisotopic Mass | 328.20384 |
| SMILES | COc1c(C(C)C)cc2c3c1OC(=O)C1CCC(C)(C)C(CC2)C31 |
| InChI | InChI=1S/C21H28O3/c1-11(2)14-10-12-6-7-15-17-13(8-9-21(15,3)4)20(22)24-19(16(12)17)18(14)23-5/h10-11,13,15,17H,6-9H2,1-5H3 |
| InChIKey | NRKDGGOZWKDHMW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-Methoxy-8,11,13-abietatrien-20,11-olide (CHEBI:174435) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 14-methoxy-7,7-dimethyl-13-propan-2-yl-2-oxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),11,13-trien-3-one |
| Manual Xrefs | Databases |
|---|---|
| 35014562 | ChemSpider |
| HMDB0038391 | HMDB |