EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15N3O3 |
| Net Charge | 0 |
| Average Mass | 189.215 |
| Monoisotopic Mass | 189.11134 |
| SMILES | NC(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H15N3O3/c8-5(6(11)12)3-1-2-4-10-7(9)13/h5H,1-4,8H2,(H,11,12)(H3,9,10,13)/t5-/m0/s1 |
| InChIKey | XIGSAGMEBXLVJJ-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homocitrulline (CHEBI:17443) has role human metabolite (CHEBI:77746) |
| L-homocitrulline (CHEBI:17443) has role mouse metabolite (CHEBI:75771) |
| L-homocitrulline (CHEBI:17443) is a L-lysine derivative (CHEBI:25095) |
| L-homocitrulline (CHEBI:17443) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-homocitrulline (CHEBI:17443) is a ureas (CHEBI:47857) |
| L-homocitrulline (CHEBI:17443) is tautomer of L-homocitrulline zwitterion (CHEBI:58148) |
| Incoming Relation(s) |
| L-homocitrulline residue (CHEBI:144369) is substituent group from L-homocitrulline (CHEBI:17443) |
| L-homocitrulline zwitterion (CHEBI:58148) is tautomer of L-homocitrulline (CHEBI:17443) |
| IUPAC Names |
|---|
| (2S)-2-amino-6-(carbamoylamino)hexanoic acid |
| N6-carbamoyl-L-lysine |
| Synonyms | Source |
|---|---|
| L-Homocitrulline | KEGG COMPOUND |
| N(6)-(aminocarbonyl)-L-lysine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02427 | KEGG COMPOUND |
| CPD-161 | MetaCyc |
| HMDB0000679 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726129 | Reaxys |
| CAS:1190-49-4 | ChemIDplus |
| CAS:1190-49-4 | KEGG COMPOUND |
| Citations |
|---|