EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O6 |
| Net Charge | 0 |
| Average Mass | 261.234 |
| Monoisotopic Mass | 261.09609 |
| SMILES | NC(=O)C[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H15N3O6/c10-4(8(15)16)1-2-7(14)12-5(9(17)18)3-6(11)13/h4-5H,1-3,10H2,(H2,11,13)(H,12,14)(H,15,16)(H,17,18)/t4-,5-/m0/s1 |
| InChIKey | LLBCGXFFHNCCQC-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gamma-glutamyl-Asparagine (CHEBI:174404) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-[[(1S)-3-amino-1-carboxy-3-oxopropyl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74854307 | ChemSpider |
| HMDB0029144 | HMDB |