EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17NO4 |
| Net Charge | 0 |
| Average Mass | 323.348 |
| Monoisotopic Mass | 323.11576 |
| SMILES | CN1CCc2cc3c(c4c2C1Cc1cc2c(cc1-4)OCO2)OCO3 |
| InChI | InChI=1S/C19H17NO4/c1-20-3-2-10-5-16-19(24-9-23-16)18-12-7-15-14(21-8-22-15)6-11(12)4-13(20)17(10)18/h5-7,13H,2-4,8-9H2,1H3 |
| InChIKey | GKEOKAJRKHTDOS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-Neolitsine (CHEBI:174350) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| 13-methyl-5,7,19,21-tetraoxa-13-azahexacyclo[10.10.1.02,10.04,8.016,23.018,22]tricosa-1(23),2,4(8),9,16,18(22)-hexaene |
| Manual Xrefs | Databases |
|---|---|
| 29365170 | ChemSpider |
| HMDB0033358 | HMDB |