EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO4 |
| Net Charge | 0 |
| Average Mass | 317.385 |
| Monoisotopic Mass | 317.16271 |
| SMILES | [H][C@@]12Oc3c(OC)ccc4c3[C@@]13CCN(C)C(C4)[C@]3(O)CC[C@@H]2O |
| InChI | InChI=1S/C18H23NO4/c1-19-8-7-17-14-10-3-4-12(22-2)15(14)23-16(17)11(20)5-6-18(17,21)13(19)9-10/h3-4,11,13,16,20-21H,5-9H2,1-2H3/t11-,13?,16-,17-,18+/m0/s1 |
| InChIKey | LHTAJTFGGUDLRH-FHHXKLHRSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alpha-oxycodol (CHEBI:174317) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4aS,7S,7aR,12bS)-9-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzouro[3,2-e]isoquinoline-4a,7-diol |
| Manual Xrefs | Databases |
|---|---|
| 35031841 | ChemSpider |
| HMDB0061077 | HMDB |