EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O4 |
| Net Charge | 0 |
| Average Mass | 246.262 |
| Monoisotopic Mass | 246.08921 |
| SMILES | CCCCC#CC(=O)c1ccc(/C=C\C(=O)O)o1 |
| InChI | InChI=1S/C14H14O4/c1-2-3-4-5-6-12(15)13-9-7-11(18-13)8-10-14(16)17/h7-10H,2-4H2,1H3,(H,16,17)/b10-8- |
| InChIKey | RZGRQFVNPYQSLD-NTMALXAHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrowyerone acid (CHEBI:174274) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| (Z)-3-(5-hept-2-ynoyluran-2-yl)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 30777349 | ChemSpider |
| HMDB0039493 | HMDB |