EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO3 |
| Net Charge | 0 |
| Average Mass | 313.397 |
| Monoisotopic Mass | 313.16779 |
| SMILES | COc1ccc2c3c1OC1C(OC)C=CC4C(C2)N(C)CCC341 |
| InChI | InChI=1S/C19H23NO3/c1-20-9-8-19-12-5-7-15(22-3)18(19)23-17-14(21-2)6-4-11(16(17)19)10-13(12)20/h4-7,12-13,15,18H,8-10H2,1-3H3 |
| InChIKey | HGPQAWTZLJXCTC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-O-Methylcodeine (CHEBI:174268) is a morphinane alkaloid (CHEBI:25418) |
| IUPAC Name |
|---|
| 7,9-dimethoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzouro[3,2-e]isoquinoline |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029381 | HMDB |
| 545921 | ChemSpider |